C17H18F3NO — CID 19765366
5-[2-(4-propoxyphenyl)ethyl]-2-(trifluoromethyl)pyridine (PubChem CID 19765366) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-[2-(4-propoxyphenyl)ethyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[2-(4-propoxyphenyl)ethyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 19765366 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 5-[2-(4-propoxyphenyl)ethyl]-2-(trifluoromethyl)pyridine |
| SMILES | CCCOc1ccc(CCc2ccc(C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C17H18F3NO/c1-2-11-22-15-8-5-13(6-9-15)3-4-14-7-10-16(21-12-14)17(18,19)20/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | YHDJKUGPUKJVOQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |