C48H54F3N3O3 — CID 67924037
5-[2-(4-butoxyphenyl)ethyl]-2-fluoropyridine;5-[2-(4-ethoxyphenyl)ethyl]-2-fluoropyridine;2-fluoro-5-[2-(4-propoxyphenyl)ethyl]pyridine (PubChem CID 67924037) has the molecular formula C48H54F3N3O3 and a molecular weight of 777.97 g/mol. Its IUPAC name is 5-[2-(4-butoxyphenyl)ethyl]-2-fluoropyridine;5-[2-(4-ethoxyphenyl)ethyl]-2-fluoropyridine;2-fluoro-5-[2-(4-propoxyphenyl)ethyl]pyridine.
| Compound Name | 5-[2-(4-butoxyphenyl)ethyl]-2-fluoropyridine;5-[2-(4-ethoxyphenyl)ethyl]-2-fluoropyridine;2-fluoro-5-[2-(4-propoxyphenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 67924037 |
| Molecular Formula | C48H54F3N3O3 |
| Molecular Weight | 777.97 g/mol |
| Exact Mass | 777.41 |
| IUPAC Name | 5-[2-(4-butoxyphenyl)ethyl]-2-fluoropyridine;5-[2-(4-ethoxyphenyl)ethyl]-2-fluoropyridine;2-fluoro-5-[2-(4-propoxyphenyl)ethyl]pyridine |
| SMILES | CCCCOc1ccc(CCc2ccc(F)nc2)cc1.CCCOc1ccc(CCc2ccc(F)nc2)cc1.CCOc1ccc(CCc2ccc(F)nc2)cc1 |
| InChI | InChI=1S/C17H20FNO.C16H18FNO.C15H16FNO/c1-2-3-12-20-16-9-6-14(7-10-16)4-5-15-8-11-17(18)19-13-15;1-2-11-19-15-8-5-13(6-9-15)3-4-14-7-10-16(17)18-12-14;1-2-18-14-8-5-12(6-9-14)3-4-13-7-10-15(16)17-11-13/h6-11,13H,2-5,12H2,1H3;5-10,12H,2-4,11H2,1H3;5-11H,2-4H2,1H3 |
| InChIKey | VPHNSVVXQYKJTN-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.97 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|