C20H22F3N — CID 19765472
2,6-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]pyridine (PubChem CID 19765472) has the molecular formula C20H22F3N and a molecular weight of 333.40 g/mol. Its IUPAC name is 2,6-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]pyridine.
| Compound Name | 2,6-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]pyridine |
|---|---|
| PubChem CID | 19765472 |
| Molecular Formula | C20H22F3N |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2,6-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]pyridine |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(F)nc3F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H22F3N/c1-2-3-13-4-6-14(7-5-13)15-8-9-16(18(21)12-15)17-10-11-19(22)24-20(17)23/h8-14H,2-7H2,1H3 |
| InChIKey | DCAFYCVUFGQVQD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|