About butan-1-olate;tetrabutylphosphanium
butan-1-olate;tetrabutylphosphanium (PubChem CID 19766644) has the molecular formula C20H45OP
and a molecular weight of 332.55 g/mol. Its IUPAC name is butan-1-olate;tetrabutylphosphanium.
Molecular Properties
| Compound Name | butan-1-olate;tetrabutylphosphanium |
| PubChem CID | 19766644 |
| Molecular Formula | C20H45OP |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | butan-1-olate;tetrabutylphosphanium |
| SMILES | CCCC[O-].CCCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36P.C4H9O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3-4-5/h5-16H2,1-4H3;2-4H2,1H3/q+1;-1 |
| InChIKey | NXQUBDVIWJSNHJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-1-olate;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-olate;tetrabutylphosphanium?
The IUPAC name of butan-1-olate;tetrabutylphosphanium (CID 19766644) is butan-1-olate;tetrabutylphosphanium.
What is the SMILES notation for butan-1-olate;tetrabutylphosphanium?
The canonical SMILES for butan-1-olate;tetrabutylphosphanium is CCCC[O-].CCCC[P+](CCCC)(CCCC)CCCC.
What is the InChIKey of butan-1-olate;tetrabutylphosphanium?
The InChIKey is NXQUBDVIWJSNHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.C4H9O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3-4-5/h5-16H2,1-4H3;2-4H2,1H3/q+1;-1.
What are the key properties of butan-1-olate;tetrabutylphosphanium?
butan-1-olate;tetrabutylphosphanium has a molecular weight of 332.55 g/mol, XLogP of 6.35, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-olate;tetrabutylphosphanium is sourced from PubChem (CID 19766644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).