C21H24O5S — CID 19767925
methyl 3-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-(3-methoxyphenyl)ethyl]benzoate (PubChem CID 19767925) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl 3-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-(3-methoxyphenyl)ethyl]benzoate.
| Compound Name | methyl 3-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-(3-methoxyphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 19767925 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl 3-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-(3-methoxyphenyl)ethyl]benzoate |
| SMILES | COC(=O)CCSC(Cc1cccc(C(=O)OC)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H24O5S/c1-24-18-9-5-7-16(14-18)19(27-11-10-20(22)25-2)13-15-6-4-8-17(12-15)21(23)26-3/h4-9,12,14,19H,10-11,13H2,1-3H3 |
| InChIKey | UCBPKPZEIRNXAV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |