C11H11N3O5 — CID 19768758
2-[[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]amino]ethylcarbamic acid (PubChem CID 19768758) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 19768758 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]amino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)c1ncoc1-c1ccco1 |
| InChI | InChI=1S/C11H11N3O5/c15-10(12-3-4-13-11(16)17)8-9(19-6-14-8)7-2-1-5-18-7/h1-2,5-6,13H,3-4H2,(H,12,15)(H,16,17) |
| InChIKey | QNJUYVDEVZGHBB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|