About (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 19770949) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate |
| PubChem CID | 19770949 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | Cc1cccn2ncc(C(=O)OC3CC4CCC(C3)N4C)c12 |
| InChI | InChI=1S/C17H21N3O2/c1-11-4-3-7-20-16(11)15(10-18-20)17(21)22-14-8-12-5-6-13(9-14)19(12)2/h3-4,7,10,12-14H,5-6,8-9H2,1-2H3 |
| InChIKey | UBWOXQNFAALKRG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate?
The IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate (CID 19770949) is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate.
What is the SMILES notation for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate?
The canonical SMILES for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate is Cc1cccn2ncc(C(=O)OC3CC4CCC(C3)N4C)c12.
What is the InChIKey of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate?
The InChIKey is UBWOXQNFAALKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-11-4-3-7-20-16(11)15(10-18-20)17(21)22-14-8-12-5-6-13(9-14)19(12)2/h3-4,7,10,12-14H,5-6,8-9H2,1-2H3.
What are the key properties of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate?
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate has a molecular weight of 299.37 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate is sourced from PubChem (CID 19770949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).