C28H32F2N2O — CID 19772101
4-fluoro-N-[1-(4-fluorophenyl)-4-phenoxy-1-piperidin-4-ylbutyl]-N-methylaniline (PubChem CID 19772101) has the molecular formula C28H32F2N2O and a molecular weight of 450.57 g/mol. Its IUPAC name is 4-fluoro-N-[1-(4-fluorophenyl)-4-phenoxy-1-piperidin-4-ylbutyl]-N-methylaniline.
| Compound Name | 4-fluoro-N-[1-(4-fluorophenyl)-4-phenoxy-1-piperidin-4-ylbutyl]-N-methylaniline |
|---|---|
| PubChem CID | 19772101 |
| Molecular Formula | C28H32F2N2O |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 4-fluoro-N-[1-(4-fluorophenyl)-4-phenoxy-1-piperidin-4-ylbutyl]-N-methylaniline |
| SMILES | CN(c1ccc(F)cc1)C(CCCOc1ccccc1)(c1ccc(F)cc1)C1CCNCC1 |
| InChI | InChI=1S/C28H32F2N2O/c1-32(26-14-12-25(30)13-15-26)28(23-16-19-31-20-17-23,22-8-10-24(29)11-9-22)18-5-21-33-27-6-3-2-4-7-27/h2-4,6-15,23,31H,5,16-21H2,1H3 |
| InChIKey | QFFUOLNEIXLXEP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|