About ethyl pentanoate;5-methylhexan-2-one
ethyl pentanoate;5-methylhexan-2-one (PubChem CID 19772684) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is ethyl pentanoate;5-methylhexan-2-one.
Molecular Properties
| Compound Name | ethyl pentanoate;5-methylhexan-2-one |
| PubChem CID | 19772684 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | ethyl pentanoate;5-methylhexan-2-one |
| SMILES | CC(=O)CCC(C)C.CCCCC(=O)OCC |
| InChI | InChI=1S/C7H14O2.C7H14O/c1-3-5-6-7(8)9-4-2;1-6(2)4-5-7(3)8/h3-6H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | JQOGVKHPXNFXDU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl pentanoate;5-methylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl pentanoate;5-methylhexan-2-one?
The IUPAC name of ethyl pentanoate;5-methylhexan-2-one (CID 19772684) is ethyl pentanoate;5-methylhexan-2-one.
What is the SMILES notation for ethyl pentanoate;5-methylhexan-2-one?
The canonical SMILES for ethyl pentanoate;5-methylhexan-2-one is CC(=O)CCC(C)C.CCCCC(=O)OCC.
What is the InChIKey of ethyl pentanoate;5-methylhexan-2-one?
The InChIKey is JQOGVKHPXNFXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C7H14O/c1-3-5-6-7(8)9-4-2;1-6(2)4-5-7(3)8/h3-6H2,1-2H3;6H,4-5H2,1-3H3.
What are the key properties of ethyl pentanoate;5-methylhexan-2-one?
ethyl pentanoate;5-methylhexan-2-one has a molecular weight of 244.37 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl pentanoate;5-methylhexan-2-one is sourced from PubChem (CID 19772684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).