C10H6N2O5 — CID 19772703
(2E,4E)-2-cyano-5-(5-nitrofuran-2-yl)penta-2,4-dienoic acid (PubChem CID 19772703) has the molecular formula C10H6N2O5 and a molecular weight of 234.17 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-(5-nitrofuran-2-yl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-cyano-5-(5-nitrofuran-2-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 19772703 |
| Molecular Formula | C10H6N2O5 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (2E,4E)-2-cyano-5-(5-nitrofuran-2-yl)penta-2,4-dienoic acid |
| SMILES | N#C/C(=C\C=C\c1ccc([N+](=O)[O-])o1)C(=O)O |
| InChI | InChI=1S/C10H6N2O5/c11-6-7(10(13)14)2-1-3-8-4-5-9(17-8)12(15)16/h1-5H,(H,13,14)/b3-1+,7-2+ |
| InChIKey | IBRPCAHKADQCBU-VMTUFMADSA-N |
| XLogP | 1.74 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|