About 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile
5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile (PubChem CID 19773033) has the molecular formula C24H20N2O2S
and a molecular weight of 400.50 g/mol. Its IUPAC name is 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile.
Molecular Properties
| Compound Name | 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile |
| PubChem CID | 19773033 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile |
| SMILES | CCC(O)(c1ccc(OCc2ccc3ccccc3c2)c(C#N)c1)c1nccs1 |
| InChI | InChI=1S/C24H20N2O2S/c1-2-24(27,23-26-11-12-29-23)21-9-10-22(20(14-21)15-25)28-16-17-7-8-18-5-3-4-6-19(18)13-17/h3-14,27H,2,16H2,1H3 |
| InChIKey | VLWRVLUMOGBUGE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile?
The IUPAC name of 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile (CID 19773033) is 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile.
What is the SMILES notation for 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile?
The canonical SMILES for 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile is CCC(O)(c1ccc(OCc2ccc3ccccc3c2)c(C#N)c1)c1nccs1.
What is the InChIKey of 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile?
The InChIKey is VLWRVLUMOGBUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O2S/c1-2-24(27,23-26-11-12-29-23)21-9-10-22(20(14-21)15-25)28-16-17-7-8-18-5-3-4-6-19(18)13-17/h3-14,27H,2,16H2,1H3.
What are the key properties of 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile?
5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile has a molecular weight of 400.50 g/mol, XLogP of 5.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-hydroxy-1-(1,3-thiazol-2-yl)propyl]-2-(naphthalen-2-ylmethoxy)benzonitrile is sourced from PubChem (CID 19773033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).