C26H32N2O3S — CID 19775330
N-[4-[[(1-benzhydryloxy-2-methylpropan-2-yl)-methylamino]methyl]phenyl]methanesulfonamide (PubChem CID 19775330) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[4-[[(1-benzhydryloxy-2-methylpropan-2-yl)-methylamino]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[[(1-benzhydryloxy-2-methylpropan-2-yl)-methylamino]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 19775330 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[4-[[(1-benzhydryloxy-2-methylpropan-2-yl)-methylamino]methyl]phenyl]methanesulfonamide |
| SMILES | CN(Cc1ccc(NS(C)(=O)=O)cc1)C(C)(C)COC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O3S/c1-26(2,28(3)19-21-15-17-24(18-16-21)27-32(4,29)30)20-31-25(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,25,27H,19-20H2,1-4H3 |
| InChIKey | PIRYMPPSKBYZLH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |