C20H23F3N2O3S — CID 24815624
N-[4-(4-ethylmorpholin-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 24815624) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[4-(4-ethylmorpholin-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(4-ethylmorpholin-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 24815624 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[4-(4-ethylmorpholin-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CCN1CCOC(C1)C2=CC=C(C=C2)NS(=O)(=O)CC3=CC(=CC=C3)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O3S/c1-2-25-10-11-28-19(13-25)16-6-8-18(9-7-16)24-29(26,27)14-15-4-3-5-17(12-15)20(21,22)23/h3-9,12,19,24H,2,10-11,13-14H2,1H3 |
| InChIKey | ZVSLURXCFVHSST-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | 615 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |