C22H37NO6 — CID 19775776
2-[[1-[(3-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-6-hydroxyhexanoic acid (PubChem CID 19775776) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-[[1-[(3-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-6-hydroxyhexanoic acid.
| Compound Name | 2-[[1-[(3-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-6-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 19775776 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[[1-[(3-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]-6-hydroxyhexanoic acid |
| SMILES | CCOC(=O)C1CCCC(NC(=O)C2(CC(CCCCO)C(=O)O)CCCC2)C1 |
| InChI | InChI=1S/C22H37NO6/c1-2-29-20(27)16-9-7-10-18(14-16)23-21(28)22(11-4-5-12-22)15-17(19(25)26)8-3-6-13-24/h16-18,24H,2-15H2,1H3,(H,23,28)(H,25,26) |
| InChIKey | NYLVPLCCSAAIEZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|