C22H32I3N3O11 — CID 19777545
5-[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodo-1-N,3-N-bis(1,4,5-trihydroxypentan-2-yl)benzene-1,3-dicarboxamide (PubChem CID 19777545) has the molecular formula C22H32I3N3O11 and a molecular weight of 895.22 g/mol. Its IUPAC name is 5-[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodo-1-N,3-N-bis(1,4,5-trihydroxypentan-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 5-[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodo-1-N,3-N-bis(1,4,5-trihydroxypentan-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19777545 |
| Molecular Formula | C22H32I3N3O11 |
| Molecular Weight | 895.22 g/mol |
| Exact Mass | 894.92 |
| IUPAC Name | 5-[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodo-1-N,3-N-bis(1,4,5-trihydroxypentan-2-yl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NC(CO)CC(O)CO)c1c(I)c(C(=O)NC(CO)CC(O)CO)c(I)c(N(CCO)C(=O)CO)c1I |
| InChI | InChI=1S/C22H32I3N3O11/c23-17-15(21(38)26-10(5-30)3-12(35)7-32)18(24)20(28(1-2-29)14(37)9-34)19(25)16(17)22(39)27-11(6-31)4-13(36)8-33/h10-13,29-36H,1-9H2,(H,26,38)(H,27,39) |
| InChIKey | AAUOGAJCAKREQQ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 240.35 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.22 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|