C18H23I3N2O10 — CID 19987836
2,3-dihydroxypropyl 3,5-bis[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodobenzoate (PubChem CID 19987836) has the molecular formula C18H23I3N2O10 and a molecular weight of 808.10 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3,5-bis[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodobenzoate.
| Compound Name | 2,3-dihydroxypropyl 3,5-bis[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 19987836 |
| Molecular Formula | C18H23I3N2O10 |
| Molecular Weight | 808.10 g/mol |
| Exact Mass | 807.85 |
| IUPAC Name | 2,3-dihydroxypropyl 3,5-bis[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodobenzoate |
| SMILES | O=C(OCC(O)CO)c1c(I)c(N(CCO)C(=O)CO)c(I)c(N(CCO)C(=O)CO)c1I |
| InChI | InChI=1S/C18H23I3N2O10/c19-13-12(18(32)33-8-9(29)5-26)14(20)17(23(2-4-25)11(31)7-28)15(21)16(13)22(1-3-24)10(30)6-27/h9,24-29H,1-8H2 |
| InChIKey | FWZHWOJHDRZLNM-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 188.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.10 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|