C6H14N2O5 — CID 88538082
1-(2,3-dihydroxypropoxy)-1-(2-hydroxyethyl)urea (PubChem CID 88538082) has the molecular formula C6H14N2O5 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropoxy)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-(2,3-dihydroxypropoxy)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 88538082 |
| Molecular Formula | C6H14N2O5 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(2,3-dihydroxypropoxy)-1-(2-hydroxyethyl)urea |
| SMILES | NC(=O)N(CCO)OCC(O)CO |
| InChI | InChI=1S/C6H14N2O5/c7-6(12)8(1-2-9)13-4-5(11)3-10/h5,9-11H,1-4H2,(H2,7,12) |
| InChIKey | HGJAAQDLSAAVGO-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|