C17H18ClN3O4S — CID 19777748
2-chloro-6-morpholin-4-ylbenzenediazonium;4-methylbenzenesulfonate (PubChem CID 19777748) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 2-chloro-6-morpholin-4-ylbenzenediazonium;4-methylbenzenesulfonate.
| Compound Name | 2-chloro-6-morpholin-4-ylbenzenediazonium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19777748 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-chloro-6-morpholin-4-ylbenzenediazonium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.N#[N+]c1c(Cl)cccc1N1CCOCC1 |
| InChI | InChI=1S/C10H11ClN3O.C7H8O3S/c11-8-2-1-3-9(10(8)13-12)14-4-6-15-7-5-14;1-6-2-4-7(5-3-6)11(8,9)10/h1-3H,4-7H2;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | MZOZIWJFBRHCHH-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|