C14H16N2O2S2 — CID 19781722
1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-3-carboxylic acid (PubChem CID 19781722) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19781722 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-3-carboxylic acid |
| SMILES | CSc1cc(NN2C=CC=C(C(=O)O)C2)cc(SC)c1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-19-12-6-11(7-13(8-12)20-2)15-16-5-3-4-10(9-16)14(17)18/h3-8,15H,9H2,1-2H3,(H,17,18) |
| InChIKey | DZFXFKHZPFROFO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |