C14H17N3OS2 — CID 54036296
1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-5-carboxamide (PubChem CID 54036296) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-5-carboxamide.
| Compound Name | 1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 54036296 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1-[3,5-bis(methylsulfanyl)anilino]-2H-pyridine-5-carboxamide |
| SMILES | CSc1cc(NN2C=C(C(N)=O)C=CC2)cc(SC)c1 |
| InChI | InChI=1S/C14H17N3OS2/c1-19-12-6-11(7-13(8-12)20-2)16-17-5-3-4-10(9-17)14(15)18/h3-4,6-9,16H,5H2,1-2H3,(H2,15,18) |
| InChIKey | LJERZHYLSYIZMA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |