C16H25Br2NO2S — CID 19782290
2,3-dibromo-N-decylbenzenesulfonamide (PubChem CID 19782290) has the molecular formula C16H25Br2NO2S and a molecular weight of 455.26 g/mol. Its IUPAC name is 2,3-dibromo-N-decylbenzenesulfonamide.
| Compound Name | 2,3-dibromo-N-decylbenzenesulfonamide |
|---|---|
| PubChem CID | 19782290 |
| Molecular Formula | C16H25Br2NO2S |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 2,3-dibromo-N-decylbenzenesulfonamide |
| SMILES | CCCCCCCCCCNS(=O)(=O)c1cccc(Br)c1Br |
| InChI | InChI=1S/C16H25Br2NO2S/c1-2-3-4-5-6-7-8-9-13-19-22(20,21)15-12-10-11-14(17)16(15)18/h10-12,19H,2-9,13H2,1H3 |
| InChIKey | OODNDKXLUSKTRI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|