C26H22N4 — CID 19783563
[9-(aminomethyl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]methanamine (PubChem CID 19783563) has the molecular formula C26H22N4 and a molecular weight of 390.49 g/mol. Its IUPAC name is [9-(aminomethyl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]methanamine.
| Compound Name | [9-(aminomethyl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]methanamine |
|---|---|
| PubChem CID | 19783563 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [9-(aminomethyl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]methanamine |
| SMILES | NCc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(CN)nc3c2n1 |
| InChI | InChI=1S/C26H22N4/c27-15-19-13-23(17-7-3-1-4-8-17)21-11-12-22-24(18-9-5-2-6-10-18)14-20(16-28)30-26(22)25(21)29-19/h1-14H,15-16,27-28H2 |
| InChIKey | MHPJRAILWDODOR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|