C40H34N4O4S2 — CID 19783564
4-methyl-N-[[9-[[(4-methylphenyl)sulfonylamino]methyl]-4,7-diphenyl-1,10-phenanthrolin-2-yl]methyl]benzenesulfonamide (PubChem CID 19783564) has the molecular formula C40H34N4O4S2 and a molecular weight of 698.87 g/mol. Its IUPAC name is 4-methyl-N-[[9-[[(4-methylphenyl)sulfonylamino]methyl]-4,7-diphenyl-1,10-phenanthrolin-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[9-[[(4-methylphenyl)sulfonylamino]methyl]-4,7-diphenyl-1,10-phenanthrolin-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19783564 |
| Molecular Formula | C40H34N4O4S2 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.20 |
| IUPAC Name | 4-methyl-N-[[9-[[(4-methylphenyl)sulfonylamino]methyl]-4,7-diphenyl-1,10-phenanthrolin-2-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cc(-c3ccccc3)c3ccc4c(-c5ccccc5)cc(CNS(=O)(=O)c5ccc(C)cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C40H34N4O4S2/c1-27-13-17-33(18-14-27)49(45,46)41-25-31-23-37(29-9-5-3-6-10-29)35-21-22-36-38(30-11-7-4-8-12-30)24-32(44-40(36)39(35)43-31)26-42-50(47,48)34-19-15-28(2)16-20-34/h3-24,41-42H,25-26H2,1-2H3 |
| InChIKey | CFUXIQWMWXGVBH-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|