C21H21FO3S — CID 19786953
4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethynylsulfanyl]-3-hydroxybutanoic acid (PubChem CID 19786953) has the molecular formula C21H21FO3S and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethynylsulfanyl]-3-hydroxybutanoic acid.
| Compound Name | 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethynylsulfanyl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19786953 |
| Molecular Formula | C21H21FO3S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[2-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]ethynylsulfanyl]-3-hydroxybutanoic acid |
| SMILES | Cc1cc(C)c(C#CSCC(O)CC(=O)O)c(-c2ccc(F)c(C)c2)c1 |
| InChI | InChI=1S/C21H21FO3S/c1-13-8-14(2)18(6-7-26-12-17(23)11-21(24)25)19(9-13)16-4-5-20(22)15(3)10-16/h4-5,8-10,17,23H,11-12H2,1-3H3,(H,24,25) |
| InChIKey | JSCHLWCQAYJZOQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|