C23H25N7 — CID 19792003
N-butyl-2-methyl-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-amine (PubChem CID 19792003) has the molecular formula C23H25N7 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-butyl-2-methyl-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-amine.
| Compound Name | N-butyl-2-methyl-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 19792003 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-butyl-2-methyl-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-amine |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)c1ccnc(C)n1 |
| InChI | InChI=1S/C23H25N7/c1-3-4-15-30(22-13-14-24-17(2)25-22)16-18-9-11-19(12-10-18)20-7-5-6-8-21(20)23-26-28-29-27-23/h5-14H,3-4,15-16H2,1-2H3,(H,26,27,28,29) |
| InChIKey | DNNZFCHECGDAFT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |