C23H24N6O3S — CID 19791774
2-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pyridine-3-sulfonic acid (PubChem CID 19791774) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pyridine-3-sulfonic acid.
| Compound Name | 2-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 19791774 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pyridine-3-sulfonic acid |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)c1ncccc1S(=O)(=O)O |
| InChI | InChI=1S/C23H24N6O3S/c1-2-3-15-29(23-21(33(30,31)32)9-6-14-24-23)16-17-10-12-18(13-11-17)19-7-4-5-8-20(19)22-25-27-28-26-22/h4-14H,2-3,15-16H2,1H3,(H,30,31,32)(H,25,26,27,28) |
| InChIKey | CGHZGTPZYNYWQW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|