C18H22N2O3 — CID 19794452
(1-methylpiperidin-2-yl)methyl 6-methoxyquinoline-3-carboxylate (PubChem CID 19794452) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1-methylpiperidin-2-yl)methyl 6-methoxyquinoline-3-carboxylate.
| Compound Name | (1-methylpiperidin-2-yl)methyl 6-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 19794452 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (1-methylpiperidin-2-yl)methyl 6-methoxyquinoline-3-carboxylate |
| SMILES | COc1ccc2ncc(C(=O)OCC3CCCCN3C)cc2c1 |
| InChI | InChI=1S/C18H22N2O3/c1-20-8-4-3-5-15(20)12-23-18(21)14-9-13-10-16(22-2)6-7-17(13)19-11-14/h6-7,9-11,15H,3-5,8,12H2,1-2H3 |
| InChIKey | NCQYUWJQOWEKTL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |