C13H18N2O2 — CID 23904865
(1-methylpiperidin-2-yl)methyl pyridine-4-carboxylate (PubChem CID 23904865) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (1-methylpiperidin-2-yl)methyl pyridine-4-carboxylate.
| Compound Name | (1-methylpiperidin-2-yl)methyl pyridine-4-carboxylate |
|---|---|
| PubChem CID | 23904865 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (1-methylpiperidin-2-yl)methyl pyridine-4-carboxylate |
| SMILES | CN1CCCCC1COC(=O)c1ccncc1 |
| InChI | InChI=1S/C13H18N2O2/c1-15-9-3-2-4-12(15)10-17-13(16)11-5-7-14-8-6-11/h5-8,12H,2-4,9-10H2,1H3 |
| InChIKey | OEMVLPOOHBXBHM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |