C27H27FN2O8S — CID 19795907
2-[[7-fluoro-1-(2-methoxy-4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl 4-methylbenzenesulfonate (PubChem CID 19795907) has the molecular formula C27H27FN2O8S and a molecular weight of 558.58 g/mol. Its IUPAC name is 2-[[7-fluoro-1-(2-methoxy-4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[[7-fluoro-1-(2-methoxy-4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19795907 |
| Molecular Formula | C27H27FN2O8S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2-[[7-fluoro-1-(2-methoxy-4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl 4-methylbenzenesulfonate |
| SMILES | COc1cc([N+](=O)[O-])ccc1C(=O)N1CCCC(OCCOS(=O)(=O)c2ccc(C)cc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C27H27FN2O8S/c1-18-5-9-21(10-6-18)39(34,35)38-15-14-37-25-4-3-13-29(24-12-7-19(28)16-23(24)25)27(31)22-11-8-20(30(32)33)17-26(22)36-2/h5-12,16-17,25H,3-4,13-15H2,1-2H3 |
| InChIKey | ALNYGRZMNBFQDB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|