C21H23FN2O5 — CID 18917459
[7-fluoro-5-(3-hydroxypropoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-(2-methyl-4-nitrophenyl)methanone (PubChem CID 18917459) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is [7-fluoro-5-(3-hydroxypropoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-(2-methyl-4-nitrophenyl)methanone.
| Compound Name | [7-fluoro-5-(3-hydroxypropoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-(2-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 18917459 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [7-fluoro-5-(3-hydroxypropoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-(2-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)N1CCCC(OCCCO)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H23FN2O5/c1-14-12-16(24(27)28)6-7-17(14)21(26)23-9-2-4-20(29-11-3-10-25)18-13-15(22)5-8-19(18)23/h5-8,12-13,20,25H,2-4,9-11H2,1H3 |
| InChIKey | MQMGWIYNEIUPHQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|