C21H22N2O6 — CID 19608219
ethyl 2-[[1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]acetate (PubChem CID 19608219) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl 2-[[1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]acetate.
| Compound Name | ethyl 2-[[1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 19608219 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 2-[[1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]acetate |
| SMILES | CCOC(=O)COC1CCCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C21H22N2O6/c1-2-28-20(24)14-29-19-8-5-13-22(18-7-4-3-6-17(18)19)21(25)15-9-11-16(12-10-15)23(26)27/h3-4,6-7,9-12,19H,2,5,8,13-14H2,1H3 |
| InChIKey | FJHCGHUJOQWNFM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|