C21H23N3O5 — CID 19608199
[1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-(dimethylamino)acetate (PubChem CID 19608199) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-(dimethylamino)acetate.
| Compound Name | [1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 19608199 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [1-(4-nitrobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 2-(dimethylamino)acetate |
| SMILES | CN(C)CC(=O)OC1CCCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C21H23N3O5/c1-22(2)14-20(25)29-19-8-5-13-23(18-7-4-3-6-17(18)19)21(26)15-9-11-16(12-10-15)24(27)28/h3-4,6-7,9-12,19H,5,8,13-14H2,1-2H3 |
| InChIKey | QDPZRFYTDMYFDS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|