C20H18ClN3O6 — CID 22071819
ethyl 2-[7-chloro-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetate (PubChem CID 22071819) has the molecular formula C20H18ClN3O6 and a molecular weight of 431.83 g/mol. Its IUPAC name is ethyl 2-[7-chloro-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetate.
| Compound Name | ethyl 2-[7-chloro-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetate |
|---|---|
| PubChem CID | 22071819 |
| Molecular Formula | C20H18ClN3O6 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | ethyl 2-[7-chloro-1-(4-nitrobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)CCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H18ClN3O6/c1-2-30-19(26)12-23-17-11-14(21)5-8-16(17)22(10-9-18(23)25)20(27)13-3-6-15(7-4-13)24(28)29/h3-8,11H,2,9-10,12H2,1H3 |
| InChIKey | MNJGUHNUYRORSR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|