C29H31NO3 — CID 19797457
methyl 3-[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)oxymethyl]benzoate (PubChem CID 19797457) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl 3-[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)oxymethyl]benzoate.
| Compound Name | methyl 3-[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 19797457 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | methyl 3-[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COC2C3CCN(CC3)C2C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H31NO3/c1-32-29(31)25-14-8-9-21(19-25)20-33-28-24-15-17-30(18-16-24)27(28)26(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-14,19,24,26-28H,15-18,20H2,1H3 |
| InChIKey | OFFUHIYCEAOYDH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |