C16H26NO5P — CID 19801625
methyl 2-[[2-(diethoxyphosphorylmethyl)phenyl]methylamino]propanoate (PubChem CID 19801625) has the molecular formula C16H26NO5P and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl 2-[[2-(diethoxyphosphorylmethyl)phenyl]methylamino]propanoate.
| Compound Name | methyl 2-[[2-(diethoxyphosphorylmethyl)phenyl]methylamino]propanoate |
|---|---|
| PubChem CID | 19801625 |
| Molecular Formula | C16H26NO5P |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | methyl 2-[[2-(diethoxyphosphorylmethyl)phenyl]methylamino]propanoate |
| SMILES | CCOP(=O)(Cc1ccccc1CNC(C)C(=O)OC)OCC |
| InChI | InChI=1S/C16H26NO5P/c1-5-21-23(19,22-6-2)12-15-10-8-7-9-14(15)11-17-13(3)16(18)20-4/h7-10,13,17H,5-6,11-12H2,1-4H3 |
| InChIKey | UJRQBQWRMHBHRM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|