C9H8N4O — CID 19801773
4-amino-6-phenyl-1,2,4-triazin-3-one (PubChem CID 19801773) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 4-amino-6-phenyl-1,2,4-triazin-3-one.
| Compound Name | 4-amino-6-phenyl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 19801773 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-amino-6-phenyl-1,2,4-triazin-3-one |
| SMILES | Nn1cc(-c2ccccc2)nnc1=O |
| InChI | InChI=1S/C9H8N4O/c10-13-6-8(11-12-9(13)14)7-4-2-1-3-5-7/h1-6H,10H2 |
| InChIKey | HHEJUPRAQSFKOV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |