C13H14ClNO5 — CID 19803400
2-acetamido-2-[[3-(chloromethyl)phenyl]methyl]propanedioic acid (PubChem CID 19803400) has the molecular formula C13H14ClNO5 and a molecular weight of 299.71 g/mol. Its IUPAC name is 2-acetamido-2-[[3-(chloromethyl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-acetamido-2-[[3-(chloromethyl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 19803400 |
| Molecular Formula | C13H14ClNO5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-acetamido-2-[[3-(chloromethyl)phenyl]methyl]propanedioic acid |
| SMILES | CC(=O)NC(Cc1cccc(CCl)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H14ClNO5/c1-8(16)15-13(11(17)18,12(19)20)6-9-3-2-4-10(5-9)7-14/h2-5H,6-7H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | FTAPRIVLGQZCQS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|