C20H28ClNO2 — CID 19804110
1-[3-(hydroxymethyl)azepan-1-yl]-3-naphthalen-1-ylpropan-2-ol;hydrochloride (PubChem CID 19804110) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)azepan-1-yl]-3-naphthalen-1-ylpropan-2-ol;hydrochloride.
| Compound Name | 1-[3-(hydroxymethyl)azepan-1-yl]-3-naphthalen-1-ylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 19804110 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[3-(hydroxymethyl)azepan-1-yl]-3-naphthalen-1-ylpropan-2-ol;hydrochloride |
| SMILES | Cl.OCC1CCCCN(CC(O)Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C20H27NO2.ClH/c22-15-16-6-3-4-11-21(13-16)14-19(23)12-18-9-5-8-17-7-1-2-10-20(17)18;/h1-2,5,7-10,16,19,22-23H,3-4,6,11-15H2;1H |
| InChIKey | NKAAIGDEFRCSAQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |