C11H9N3OS — CID 19806579
6-imidazol-1-yl-1,4-dihydro-3,1-benzothiazin-2-one (PubChem CID 19806579) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 6-imidazol-1-yl-1,4-dihydro-3,1-benzothiazin-2-one.
| Compound Name | 6-imidazol-1-yl-1,4-dihydro-3,1-benzothiazin-2-one |
|---|---|
| PubChem CID | 19806579 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 6-imidazol-1-yl-1,4-dihydro-3,1-benzothiazin-2-one |
| SMILES | O=C1Nc2ccc(-n3ccnc3)cc2CS1 |
| InChI | InChI=1S/C11H9N3OS/c15-11-13-10-2-1-9(5-8(10)6-16-11)14-4-3-12-7-14/h1-5,7H,6H2,(H,13,15) |
| InChIKey | IIYREIGPJKLDTF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|