C20H27N3O2S — CID 19809352
N-(1-benzyl-2,4-dimethyl-1,4-diazepan-2-yl)benzenesulfonamide (PubChem CID 19809352) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-(1-benzyl-2,4-dimethyl-1,4-diazepan-2-yl)benzenesulfonamide.
| Compound Name | N-(1-benzyl-2,4-dimethyl-1,4-diazepan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19809352 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(1-benzyl-2,4-dimethyl-1,4-diazepan-2-yl)benzenesulfonamide |
| SMILES | CN1CCCN(Cc2ccccc2)C(C)(NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O2S/c1-20(21-26(24,25)19-12-7-4-8-13-19)17-22(2)14-9-15-23(20)16-18-10-5-3-6-11-18/h3-8,10-13,21H,9,14-17H2,1-2H3 |
| InChIKey | PFSNGPZESZGLJW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |