C29H32N2O2 — CID 19811653
methyl 4-[[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)amino]methyl]benzoate (PubChem CID 19811653) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is methyl 4-[[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 19811653 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | methyl 4-[[(2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC2C3CCN(CC3)C2C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O2/c1-33-29(32)25-14-12-21(13-15-25)20-30-27-24-16-18-31(19-17-24)28(27)26(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-15,24,26-28,30H,16-20H2,1H3 |
| InChIKey | YBNFKQXESLGWRK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |