About 5-ethenyl-2,4-benzodioxepine
5-ethenyl-2,4-benzodioxepine (PubChem CID 19812424) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-ethenyl-2,4-benzodioxepine.
Molecular Properties
| Compound Name | 5-ethenyl-2,4-benzodioxepine |
| PubChem CID | 19812424 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 5-ethenyl-2,4-benzodioxepine |
| SMILES | C=CC1=c2ccccc2=COCO1 |
| InChI | InChI=1S/C11H10O2/c1-2-11-10-6-4-3-5-9(10)7-12-8-13-11/h2-7H,1,8H2 |
| InChIKey | NNKDPDFLFQUTQV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-2,4-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2,4-benzodioxepine?
The IUPAC name of 5-ethenyl-2,4-benzodioxepine (CID 19812424) is 5-ethenyl-2,4-benzodioxepine.
What is the SMILES notation for 5-ethenyl-2,4-benzodioxepine?
The canonical SMILES for 5-ethenyl-2,4-benzodioxepine is C=CC1=c2ccccc2=COCO1.
What is the InChIKey of 5-ethenyl-2,4-benzodioxepine?
The InChIKey is NNKDPDFLFQUTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c1-2-11-10-6-4-3-5-9(10)7-12-8-13-11/h2-7H,1,8H2.
What are the key properties of 5-ethenyl-2,4-benzodioxepine?
5-ethenyl-2,4-benzodioxepine has a molecular weight of 174.20 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2,4-benzodioxepine is sourced from PubChem (CID 19812424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).