C8H8O2 — CID 162393126
5-methylidene-4H-1,3-benzodioxole (PubChem CID 162393126) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is 5-methylidene-4H-1,3-benzodioxole.
| Compound Name | 5-methylidene-4H-1,3-benzodioxole |
|---|---|
| PubChem CID | 162393126 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 5-methylidene-4H-1,3-benzodioxole |
| SMILES | C=C1C=CC2=C(C1)OCO2 |
| InChI | InChI=1S/C8H8O2/c1-6-2-3-7-8(4-6)10-5-9-7/h2-3H,1,4-5H2 |
| InChIKey | FBALBFIGKOXFIT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |