C10H8O4 — CID 134873049
[5-(methoxymethoxy)-6-(oxomethylidene)cyclohexa-2,4-dien-1-ylidene]methanone (PubChem CID 134873049) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is [5-(methoxymethoxy)-6-(oxomethylidene)cyclohexa-2,4-dien-1-ylidene]methanone.
| Compound Name | [5-(methoxymethoxy)-6-(oxomethylidene)cyclohexa-2,4-dien-1-ylidene]methanone |
|---|---|
| PubChem CID | 134873049 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | [5-(methoxymethoxy)-6-(oxomethylidene)cyclohexa-2,4-dien-1-ylidene]methanone |
| SMILES | COCOc1cccc(=C=O)c1=C=O |
| InChI | InChI=1S/C10H8O4/c1-13-7-14-10-4-2-3-8(5-11)9(10)6-12/h2-4H,7H2,1H3 |
| InChIKey | RENLJOXXVLKDPW-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|