C15H12O2 — CID 19853412
2,2'-spirobi[4H-1-benzofuran] (PubChem CID 19853412) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,2'-spirobi[4H-1-benzofuran].
| Compound Name | 2,2'-spirobi[4H-1-benzofuran] |
|---|---|
| PubChem CID | 19853412 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2,2'-spirobi[4H-1-benzofuran] |
| SMILES | C1=CCC2=CC3(C=C4CC=CC=C4O3)OC2=C1 |
| InChI | InChI=1S/C15H12O2/c1-3-7-13-11(5-1)9-15(16-13)10-12-6-2-4-8-14(12)17-15/h1-4,7-10H,5-6H2 |
| InChIKey | TVNCDLOQMKXBIH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |