C11H12O3 — CID 91420829
2,3-dimethoxy-5H-chromene (PubChem CID 91420829) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2,3-dimethoxy-5H-chromene.
| Compound Name | 2,3-dimethoxy-5H-chromene |
|---|---|
| PubChem CID | 91420829 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2,3-dimethoxy-5H-chromene |
| SMILES | COC1=C(OC)OC2=CC=CCC2=C1 |
| InChI | InChI=1S/C11H12O3/c1-12-10-7-8-5-3-4-6-9(8)14-11(10)13-2/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | ITYLFLOYMUTJLS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |