About 8H-cyclopenta[f][1,3]benzodioxole
8H-cyclopenta[f][1,3]benzodioxole (PubChem CID 142694134) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is 8H-cyclopenta[f][1,3]benzodioxole.
Molecular Properties
| Compound Name | 8H-cyclopenta[f][1,3]benzodioxole |
| PubChem CID | 142694134 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 8H-cyclopenta[f][1,3]benzodioxole |
| SMILES | C1=CC2=CC3=C(CC2=C1)OCO3 |
| InChI | InChI=1S/C10H8O2/c1-2-7-4-9-10(12-6-11-9)5-8(7)3-1/h1-4H,5-6H2 |
| InChIKey | WHNROZLXUSRLTL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8H-cyclopenta[f][1,3]benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-cyclopenta[f][1,3]benzodioxole?
The IUPAC name of 8H-cyclopenta[f][1,3]benzodioxole (CID 142694134) is 8H-cyclopenta[f][1,3]benzodioxole.
What is the SMILES notation for 8H-cyclopenta[f][1,3]benzodioxole?
The canonical SMILES for 8H-cyclopenta[f][1,3]benzodioxole is C1=CC2=CC3=C(CC2=C1)OCO3.
What is the InChIKey of 8H-cyclopenta[f][1,3]benzodioxole?
The InChIKey is WHNROZLXUSRLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c1-2-7-4-9-10(12-6-11-9)5-8(7)3-1/h1-4H,5-6H2.
What are the key properties of 8H-cyclopenta[f][1,3]benzodioxole?
8H-cyclopenta[f][1,3]benzodioxole has a molecular weight of 160.17 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-cyclopenta[f][1,3]benzodioxole is sourced from PubChem (CID 142694134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).