C16H18Cl2N2O — CID 19814414
N-butyl-2,3-dichloro-4-(pyridin-2-ylmethoxy)aniline (PubChem CID 19814414) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is N-butyl-2,3-dichloro-4-(pyridin-2-ylmethoxy)aniline.
| Compound Name | N-butyl-2,3-dichloro-4-(pyridin-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 19814414 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-butyl-2,3-dichloro-4-(pyridin-2-ylmethoxy)aniline |
| SMILES | CCCCNc1ccc(OCc2ccccn2)c(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c1-2-3-9-20-13-7-8-14(16(18)15(13)17)21-11-12-6-4-5-10-19-12/h4-8,10,20H,2-3,9,11H2,1H3 |
| InChIKey | BSPHXVVITSFQFS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|