C12H9N3O2 — CID 19816499
4-(benzotriazol-1-yl)benzene-1,3-diol (PubChem CID 19816499) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)benzene-1,3-diol.
| Compound Name | 4-(benzotriazol-1-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 19816499 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 4-(benzotriazol-1-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(-n2nnc3ccccc32)c(O)c1 |
| InChI | InChI=1S/C12H9N3O2/c16-8-5-6-11(12(17)7-8)15-10-4-2-1-3-9(10)13-14-15/h1-7,16-17H |
| InChIKey | SCTIHYMVZGJQDZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |