C20H15N3O2S — CID 25031143
4-[5-(2-phenylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol (PubChem CID 25031143) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 4-[5-(2-phenylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol.
| Compound Name | 4-[5-(2-phenylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 25031143 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-[5-(2-phenylphenyl)-4-sulfanyltriazol-1-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-n2nnc(S)c2-c2ccccc2-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C20H15N3O2S/c24-14-10-11-17(18(25)12-14)23-19(20(26)21-22-23)16-9-5-4-8-15(16)13-6-2-1-3-7-13/h1-12,24-26H |
| InChIKey | WVGFMPBFGBVGGH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|